About 9-ethenyl-2,7-dimethyl-9H-fluorene
9-ethenyl-2,7-dimethyl-9H-fluorene (PubChem CID 22619298) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is 9-ethenyl-2,7-dimethyl-9H-fluorene.
Molecular Properties
| Compound Name | 9-ethenyl-2,7-dimethyl-9H-fluorene |
| PubChem CID | 22619298 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 9-ethenyl-2,7-dimethyl-9H-fluorene |
| SMILES | C=CC1c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C17H16/c1-4-13-16-9-11(2)5-7-14(16)15-8-6-12(3)10-17(13)15/h4-10,13H,1H2,2-3H3 |
| InChIKey | HRSXBALFLXVSAU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethenyl-2,7-dimethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenyl-2,7-dimethyl-9H-fluorene?
The IUPAC name of 9-ethenyl-2,7-dimethyl-9H-fluorene (CID 22619298) is 9-ethenyl-2,7-dimethyl-9H-fluorene.
What is the SMILES notation for 9-ethenyl-2,7-dimethyl-9H-fluorene?
The canonical SMILES for 9-ethenyl-2,7-dimethyl-9H-fluorene is C=CC1c2cc(C)ccc2-c2ccc(C)cc21.
What is the InChIKey of 9-ethenyl-2,7-dimethyl-9H-fluorene?
The InChIKey is HRSXBALFLXVSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16/c1-4-13-16-9-11(2)5-7-14(16)15-8-6-12(3)10-17(13)15/h4-10,13H,1H2,2-3H3.
What are the key properties of 9-ethenyl-2,7-dimethyl-9H-fluorene?
9-ethenyl-2,7-dimethyl-9H-fluorene has a molecular weight of 220.31 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenyl-2,7-dimethyl-9H-fluorene is sourced from PubChem (CID 22619298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).