About sodium piperidine-2,6-dione
sodium piperidine-2,6-dione (PubChem CID 22619648) has the molecular formula C5H7NNaO2+
and a molecular weight of 136.11 g/mol. Its IUPAC name is sodium piperidine-2,6-dione.
Molecular Properties
| Compound Name | sodium piperidine-2,6-dione |
| PubChem CID | 22619648 |
| Molecular Formula | C5H7NNaO2+ |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | sodium piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1.[Na+] |
| InChI | InChI=1S/C5H7NO2.Na/c7-4-2-1-3-5(8)6-4;/h1-3H2,(H,6,7,8);/q;+1 |
| InChIKey | UVAXXPDZDOJVCZ-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze sodium piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium piperidine-2,6-dione?
The IUPAC name of sodium piperidine-2,6-dione (CID 22619648) is sodium piperidine-2,6-dione.
What is the SMILES notation for sodium piperidine-2,6-dione?
The canonical SMILES for sodium piperidine-2,6-dione is O=C1CCCC(=O)N1.[Na+].
What is the InChIKey of sodium piperidine-2,6-dione?
The InChIKey is UVAXXPDZDOJVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.Na/c7-4-2-1-3-5(8)6-4;/h1-3H2,(H,6,7,8);/q;+1.
What are the key properties of sodium piperidine-2,6-dione?
sodium piperidine-2,6-dione has a molecular weight of 136.11 g/mol, XLogP of -3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium piperidine-2,6-dione is sourced from PubChem (CID 22619648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).