About 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one
6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 22619823) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 22619823 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | COc1cc2c(cc1OC)NC(C)C(=O)N2 |
| InChI | InChI=1S/C11H14N2O3/c1-6-11(14)13-8-5-10(16-3)9(15-2)4-7(8)12-6/h4-6,12H,1-3H3,(H,13,14) |
| InChIKey | VQJWYJFQEBOUOX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one (CID 22619823) is 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one is COc1cc2c(cc1OC)NC(C)C(=O)N2.
What is the InChIKey of 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is VQJWYJFQEBOUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-6-11(14)13-8-5-10(16-3)9(15-2)4-7(8)12-6/h4-6,12H,1-3H3,(H,13,14).
What are the key properties of 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one?
6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 222.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-methyl-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 22619823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).