C18H26ClN5O5S — CID 22619921
4-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-N-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxamide (PubChem CID 22619921) has the molecular formula C18H26ClN5O5S and a molecular weight of 459.96 g/mol. Its IUPAC name is 4-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-N-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxamide.
| Compound Name | 4-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-N-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 22619921 |
| Molecular Formula | C18H26ClN5O5S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-N-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxamide |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(NC2CC(C(=O)NCC)C3OC(C)(C)OC23)n1 |
| InChI | InChI=1S/C18H26ClN5O5S/c1-5-7-30-17-22-14(19)11(24(26)27)15(23-17)21-10-8-9(16(25)20-6-2)12-13(10)29-18(3,4)28-12/h9-10,12-13H,5-8H2,1-4H3,(H,20,25)(H,21,22,23) |
| InChIKey | TUICRZKWSPNVDL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|