tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate

C16H29NO3 — CID 22620200

IUPACtert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate
SMILESCCC(C)C(=O)C1CCCC(C)N1C(=O)OC(C)(C)C
InChIInChI=1S/C16H29NO3/c1-7-11(2)14(18)13-10-8-9-12(3)17(13)15(19)20-16(4,5)6/h11-13H,7-10H2,1-6H3
InChIKeyHGIKLDLPXUMXSO-UHFFFAOYSA-N
MW283.41 g/mol
LogP3.78
Rot. Bonds3

About tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate

tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate (PubChem CID 22620200) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate
PubChem CID22620200
Molecular FormulaC16H29NO3
Molecular Weight283.41 g/mol
Exact Mass283.21
IUPAC Nametert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate
SMILESCCC(C)C(=O)C1CCCC(C)N1C(=O)OC(C)(C)C
InChIInChI=1S/C16H29NO3/c1-7-11(2)14(18)13-10-8-9-12(3)17(13)15(19)20-16(4,5)6/h11-13H,7-10H2,1-6H3
InChIKeyHGIKLDLPXUMXSO-UHFFFAOYSA-N
XLogP3.78
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.41
LogP ≤ 53.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate (CID 22620200) is tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate is CCC(C)C(=O)C1CCCC(C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate?
The InChIKey is HGIKLDLPXUMXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-7-11(2)14(18)13-10-8-9-12(3)17(13)15(19)20-16(4,5)6/h11-13H,7-10H2,1-6H3.
What are the key properties of tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate?
tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate has a molecular weight of 283.41 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methyl-6-(2-methylbutanoyl)piperidine-1-carboxylate is sourced from PubChem (CID 22620200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).