C11H8F10O2 — CID 22620649
(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 2-methylprop-2-enoate (PubChem CID 22620649) has the molecular formula C11H8F10O2 and a molecular weight of 362.16 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 2-methylprop-2-enoate.
| Compound Name | (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22620649 |
| Molecular Formula | C11H8F10O2 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H8F10O2/c1-4(2)6(22)23-3-5-7(12,13)9(16,17)11(20,21)10(18,19)8(5,14)15/h5H,1,3H2,2H3 |
| InChIKey | RYXXDBBOFQIZFW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|