C12H11F6NO2S — CID 22620699
2,2,2-trifluoroacetic acid;8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine (PubChem CID 22620699) has the molecular formula C12H11F6NO2S and a molecular weight of 347.28 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine.
| Compound Name | 2,2,2-trifluoroacetic acid;8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 22620699 |
| Molecular Formula | C12H11F6NO2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine |
| SMILES | FC(F)(F)c1ccc2c(c1)SCCCN2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NS.C2HF3O2/c11-10(12,13)7-2-3-8-9(6-7)15-5-1-4-14-8;3-2(4,5)1(6)7/h2-3,6,14H,1,4-5H2;(H,6,7) |
| InChIKey | XJKZQEDBPRYDOH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |