C12H12BrNO — CID 22620743
1-(5-bromo-1,2-dihydro-3-benzazepin-3-yl)ethanone (PubChem CID 22620743) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 1-(5-bromo-1,2-dihydro-3-benzazepin-3-yl)ethanone.
| Compound Name | 1-(5-bromo-1,2-dihydro-3-benzazepin-3-yl)ethanone |
|---|---|
| PubChem CID | 22620743 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 1-(5-bromo-1,2-dihydro-3-benzazepin-3-yl)ethanone |
| SMILES | CC(=O)N1C=C(Br)c2ccccc2CC1 |
| InChI | InChI=1S/C12H12BrNO/c1-9(15)14-7-6-10-4-2-3-5-11(10)12(13)8-14/h2-5,8H,6-7H2,1H3 |
| InChIKey | ARMSVRBUSGVGCO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |