C8H11N3 — CID 22620753
6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine (PubChem CID 22620753) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine.
| Compound Name | 6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 22620753 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
| SMILES | c1ncc2c(n1)CCNCC2 |
| InChI | InChI=1S/C8H11N3/c1-3-9-4-2-8-7(1)5-10-6-11-8/h5-6,9H,1-4H2 |
| InChIKey | GSBPAKVXTRJZPG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |