About oxolane;phenoxybenzene
oxolane;phenoxybenzene (PubChem CID 22620896) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is oxolane;phenoxybenzene.
Molecular Properties
| Compound Name | oxolane;phenoxybenzene |
| PubChem CID | 22620896 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | oxolane;phenoxybenzene |
| SMILES | C1CCOC1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C4H8O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10H;1-4H2 |
| InChIKey | UPZFGZWGGFFLRT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxolane;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;phenoxybenzene?
The IUPAC name of oxolane;phenoxybenzene (CID 22620896) is oxolane;phenoxybenzene.
What is the SMILES notation for oxolane;phenoxybenzene?
The canonical SMILES for oxolane;phenoxybenzene is C1CCOC1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of oxolane;phenoxybenzene?
The InChIKey is UPZFGZWGGFFLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C4H8O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10H;1-4H2.
What are the key properties of oxolane;phenoxybenzene?
oxolane;phenoxybenzene has a molecular weight of 242.32 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;phenoxybenzene is sourced from PubChem (CID 22620896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).