About methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate
methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate (PubChem CID 22621100) has the molecular formula C17H16F2N2O4
and a molecular weight of 350.32 g/mol. Its IUPAC name is methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate.
Molecular Properties
| Compound Name | methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate |
| PubChem CID | 22621100 |
| Molecular Formula | C17H16F2N2O4 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC)c1c(C(=O)c2cnoc2C2CC2)ccc(F)c1F |
| InChI | InChI=1S/C17H16F2N2O4/c1-3-21(17(23)24-2)14-10(6-7-12(18)13(14)19)15(22)11-8-20-25-16(11)9-4-5-9/h6-9H,3-5H2,1-2H3 |
| InChIKey | TYTDVUNTNNJKQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate?
The IUPAC name of methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate (CID 22621100) is methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate.
What is the SMILES notation for methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate?
The canonical SMILES for methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate is CCN(C(=O)OC)c1c(C(=O)c2cnoc2C2CC2)ccc(F)c1F.
What is the InChIKey of methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate?
The InChIKey is TYTDVUNTNNJKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2O4/c1-3-21(17(23)24-2)14-10(6-7-12(18)13(14)19)15(22)11-8-20-25-16(11)9-4-5-9/h6-9H,3-5H2,1-2H3.
What are the key properties of methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate?
methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate has a molecular weight of 350.32 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-difluorophenyl]-N-ethylcarbamate is sourced from PubChem (CID 22621100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).