C8H13F7N2O2S — CID 22621389
N-(butylsulfamoyl)-2,2,3,3,4,4,4-heptafluorobutan-1-amine (PubChem CID 22621389) has the molecular formula C8H13F7N2O2S and a molecular weight of 334.26 g/mol. Its IUPAC name is N-(butylsulfamoyl)-2,2,3,3,4,4,4-heptafluorobutan-1-amine.
| Compound Name | N-(butylsulfamoyl)-2,2,3,3,4,4,4-heptafluorobutan-1-amine |
|---|---|
| PubChem CID | 22621389 |
| Molecular Formula | C8H13F7N2O2S |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-(butylsulfamoyl)-2,2,3,3,4,4,4-heptafluorobutan-1-amine |
| SMILES | CCCCNS(=O)(=O)NCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F7N2O2S/c1-2-3-4-16-20(18,19)17-5-6(9,10)7(11,12)8(13,14)15/h16-17H,2-5H2,1H3 |
| InChIKey | OZJOBTNRLDYNDL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|