C7H13F5N2O2S — CID 22621391
N-(2,2,3,3,3-pentafluoropropylsulfamoyl)butan-1-amine (PubChem CID 22621391) has the molecular formula C7H13F5N2O2S and a molecular weight of 284.25 g/mol. Its IUPAC name is N-(2,2,3,3,3-pentafluoropropylsulfamoyl)butan-1-amine.
| Compound Name | N-(2,2,3,3,3-pentafluoropropylsulfamoyl)butan-1-amine |
|---|---|
| PubChem CID | 22621391 |
| Molecular Formula | C7H13F5N2O2S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-(2,2,3,3,3-pentafluoropropylsulfamoyl)butan-1-amine |
| SMILES | CCCCNS(=O)(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13F5N2O2S/c1-2-3-4-13-17(15,16)14-5-6(8,9)7(10,11)12/h13-14H,2-5H2,1H3 |
| InChIKey | GUGVRKWYXJXQGR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|