About N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine
N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine (PubChem CID 22621393) has the molecular formula C6H13F3N2O2S
and a molecular weight of 234.24 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine |
| PubChem CID | 22621393 |
| Molecular Formula | C6H13F3N2O2S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine |
| SMILES | CCCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O2S/c1-2-3-4-10-14(12,13)11-5-6(7,8)9/h10-11H,2-5H2,1H3 |
| InChIKey | GAEOAEQDDZEUQB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine?
The IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine (CID 22621393) is N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine.
What is the SMILES notation for N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine?
The canonical SMILES for N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine is CCCCNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine?
The InChIKey is GAEOAEQDDZEUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3N2O2S/c1-2-3-4-10-14(12,13)11-5-6(7,8)9/h10-11H,2-5H2,1H3.
What are the key properties of N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine?
N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine has a molecular weight of 234.24 g/mol, XLogP of 0.77, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine is sourced from PubChem (CID 22621393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).