About 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol
2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol (PubChem CID 2262182) has the molecular formula C11H15Cl2NO2
and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol |
| PubChem CID | 2262182 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCCNCCO |
| InChI | InChI=1S/C11H15Cl2NO2/c1-8-6-9(12)7-10(13)11(8)16-5-3-14-2-4-15/h6-7,14-15H,2-5H2,1H3 |
| InChIKey | SKFPNMHQQQSZRZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol?
The IUPAC name of 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol (CID 2262182) is 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol.
What is the SMILES notation for 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol?
The canonical SMILES for 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol is Cc1cc(Cl)cc(Cl)c1OCCNCCO.
What is the InChIKey of 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol?
The InChIKey is SKFPNMHQQQSZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2NO2/c1-8-6-9(12)7-10(13)11(8)16-5-3-14-2-4-15/h6-7,14-15H,2-5H2,1H3.
What are the key properties of 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol?
2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol has a molecular weight of 264.15 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichloro-6-methylphenoxy)ethylamino]ethanol is sourced from PubChem (CID 2262182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).