C11H8N2 — CID 22622032
1H-pyrrolo[2,3-g]isoquinoline (PubChem CID 22622032) has the molecular formula C11H8N2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-g]isoquinoline.
| Compound Name | 1H-pyrrolo[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 22622032 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1H-pyrrolo[2,3-g]isoquinoline |
| SMILES | c1cc2cc3[nH]ccc3cc2cn1 |
| InChI | InChI=1S/C11H8N2/c1-3-12-7-10-5-9-2-4-13-11(9)6-8(1)10/h1-7,13H |
| InChIKey | AWDQDYKOPKYYHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |