About 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide
3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide (PubChem CID 22622295) has the molecular formula C23H20F2N2O2
and a molecular weight of 394.42 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide |
| PubChem CID | 22622295 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide |
| SMILES | CN(CC(CCO)c1ccc(F)c(F)c1)C(=O)c1cc(C#N)cc2ccccc12 |
| InChI | InChI=1S/C23H20F2N2O2/c1-27(14-18(8-9-28)16-6-7-21(24)22(25)12-16)23(29)20-11-15(13-26)10-17-4-2-3-5-19(17)20/h2-7,10-12,18,28H,8-9,14H2,1H3 |
| InChIKey | HOZPWLSVGBMSQP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide?
The IUPAC name of 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide (CID 22622295) is 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide.
What is the SMILES notation for 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide?
The canonical SMILES for 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide is CN(CC(CCO)c1ccc(F)c(F)c1)C(=O)c1cc(C#N)cc2ccccc12.
What is the InChIKey of 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide?
The InChIKey is HOZPWLSVGBMSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2N2O2/c1-27(14-18(8-9-28)16-6-7-21(24)22(25)12-16)23(29)20-11-15(13-26)10-17-4-2-3-5-19(17)20/h2-7,10-12,18,28H,8-9,14H2,1H3.
What are the key properties of 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide?
3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide has a molecular weight of 394.42 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]-N-methylnaphthalene-1-carboxamide is sourced from PubChem (CID 22622295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).