C51H90N12O3 — CID 22622815
1-[2-[[4,6-bis[cyclohexyl-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]amino]-1,3,5-triazin-2-yl]-cyclohexylamino]ethyl]-3,3,5,5-tetramethylpiperazin-2-one (PubChem CID 22622815) has the molecular formula C51H90N12O3 and a molecular weight of 919.36 g/mol. Its IUPAC name is 1-[2-[[4,6-bis[cyclohexyl-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]amino]-1,3,5-triazin-2-yl]-cyclohexylamino]ethyl]-3,3,5,5-tetramethylpiperazin-2-one.
| Compound Name | 1-[2-[[4,6-bis[cyclohexyl-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]amino]-1,3,5-triazin-2-yl]-cyclohexylamino]ethyl]-3,3,5,5-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 22622815 |
| Molecular Formula | C51H90N12O3 |
| Molecular Weight | 919.36 g/mol |
| Exact Mass | 918.73 |
| IUPAC Name | 1-[2-[[4,6-bis[cyclohexyl-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]amino]-1,3,5-triazin-2-yl]-cyclohexylamino]ethyl]-3,3,5,5-tetramethylpiperazin-2-one |
| SMILES | CC1(C)CN(CCN(c2nc(N(CCN3CC(C)(C)NC(C)(C)C3=O)C3CCCCC3)nc(N(CCN3CC(C)(C)NC(C)(C)C3=O)C3CCCCC3)n2)C2CCCCC2)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C51H90N12O3/c1-46(2)34-58(40(64)49(7,8)55-46)28-31-61(37-22-16-13-17-23-37)43-52-44(62(38-24-18-14-19-25-38)32-29-59-35-47(3,4)56-50(9,10)41(59)65)54-45(53-43)63(39-26-20-15-21-27-39)33-30-60-36-48(5,6)57-51(11,12)42(60)66/h37-39,55-57H,13-36H2,1-12H3 |
| InChIKey | VPYDVGWWXAYRPP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.36 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |