About 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one
6-bromo-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 22622903) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 22622903 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(Br)cc2NC1=O |
| InChI | InChI=1S/C9H8BrNO2/c1-5-9(12)11-7-4-6(10)2-3-8(7)13-5/h2-5H,1H3,(H,11,12) |
| InChIKey | NUXLDNTZFXDNBA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one (CID 22622903) is 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one is CC1Oc2ccc(Br)cc2NC1=O.
What is the InChIKey of 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one?
The InChIKey is NUXLDNTZFXDNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c1-5-9(12)11-7-4-6(10)2-3-8(7)13-5/h2-5H,1H3,(H,11,12).
What are the key properties of 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one?
6-bromo-2-methyl-4H-1,4-benzoxazin-3-one has a molecular weight of 242.07 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 22622903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).