C20ClF21 — CID 22623376
1-chloro-2,3,4,5,6,7,8-heptafluoro-9,10-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene (PubChem CID 22623376) has the molecular formula C20ClF21 and a molecular weight of 674.63 g/mol. Its IUPAC name is 1-chloro-2,3,4,5,6,7,8-heptafluoro-9,10-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene.
| Compound Name | 1-chloro-2,3,4,5,6,7,8-heptafluoro-9,10-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene |
|---|---|
| PubChem CID | 22623376 |
| Molecular Formula | C20ClF21 |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 673.94 |
| IUPAC Name | 1-chloro-2,3,4,5,6,7,8-heptafluoro-9,10-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene |
| SMILES | Fc1c(F)c(F)c2c(C(F)(F)C(F)(F)C(F)(F)F)c3c(Cl)c(F)c(F)c(F)c3c(C(F)(F)C(F)(F)C(F)(F)F)c2c1F |
| InChI | InChI=1S/C20ClF21/c21-7-1-2(8(22)12(26)11(7)25)6(16(31,32)18(35,36)20(40,41)42)4-3(9(23)13(27)14(28)10(4)24)5(1)15(29,30)17(33,34)19(37,38)39 |
| InChIKey | NGVGEUTYSRZNTC-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|