About 1,2-diethylaziridine
1,2-diethylaziridine (PubChem CID 22623468) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is 1,2-diethylaziridine.
Molecular Properties
| Compound Name | 1,2-diethylaziridine |
| PubChem CID | 22623468 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | 1,2-diethylaziridine |
| SMILES | CCC1CN1CC |
| InChI | InChI=1S/C6H13N/c1-3-6-5-7(6)4-2/h6H,3-5H2,1-2H3 |
| InChIKey | OOCFZXAIPSMXEL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethylaziridine?
The IUPAC name of 1,2-diethylaziridine (CID 22623468) is 1,2-diethylaziridine.
What is the SMILES notation for 1,2-diethylaziridine?
The canonical SMILES for 1,2-diethylaziridine is CCC1CN1CC.
What is the InChIKey of 1,2-diethylaziridine?
The InChIKey is OOCFZXAIPSMXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N/c1-3-6-5-7(6)4-2/h6H,3-5H2,1-2H3.
What are the key properties of 1,2-diethylaziridine?
1,2-diethylaziridine has a molecular weight of 99.18 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethylaziridine is sourced from PubChem (CID 22623468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).