About 8-chlorononane-1-thiol
8-chlorononane-1-thiol (PubChem CID 22623746) has the molecular formula C9H19ClS
and a molecular weight of 194.77 g/mol. Its IUPAC name is 8-chlorononane-1-thiol.
Molecular Properties
| Compound Name | 8-chlorononane-1-thiol |
| PubChem CID | 22623746 |
| Molecular Formula | C9H19ClS |
| Molecular Weight | 194.77 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 8-chlorononane-1-thiol |
| SMILES | CC(Cl)CCCCCCCS |
| InChI | InChI=1S/C9H19ClS/c1-9(10)7-5-3-2-4-6-8-11/h9,11H,2-8H2,1H3 |
| InChIKey | WWOUSDBSVXCNHJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-chlorononane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorononane-1-thiol?
The IUPAC name of 8-chlorononane-1-thiol (CID 22623746) is 8-chlorononane-1-thiol.
What is the SMILES notation for 8-chlorononane-1-thiol?
The canonical SMILES for 8-chlorononane-1-thiol is CC(Cl)CCCCCCCS.
What is the InChIKey of 8-chlorononane-1-thiol?
The InChIKey is WWOUSDBSVXCNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19ClS/c1-9(10)7-5-3-2-4-6-8-11/h9,11H,2-8H2,1H3.
What are the key properties of 8-chlorononane-1-thiol?
8-chlorononane-1-thiol has a molecular weight of 194.77 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorononane-1-thiol is sourced from PubChem (CID 22623746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).