C8H2Na4O9 — CID 22623777
tetrasodium;2,5-dihydrofuran-2,3,4,5-tetracarboxylate (PubChem CID 22623777) has the molecular formula C8H2Na4O9 and a molecular weight of 334.06 g/mol. Its IUPAC name is tetrasodium;2,5-dihydrofuran-2,3,4,5-tetracarboxylate.
| Compound Name | tetrasodium;2,5-dihydrofuran-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 22623777 |
| Molecular Formula | C8H2Na4O9 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | tetrasodium;2,5-dihydrofuran-2,3,4,5-tetracarboxylate |
| SMILES | O=C([O-])C1=C(C(=O)[O-])C(C(=O)[O-])OC1C(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C8H6O9.4Na/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14;;;;/h3-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16);;;;/q;4*+1/p-4 |
| InChIKey | QFKFSQYSBMCRMV-UHFFFAOYSA-J |
| XLogP | -18.93 |
| TPSA | 169.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | -18.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |