C14H8O5 — CID 22623907
3,5,11-trioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione (PubChem CID 22623907) has the molecular formula C14H8O5 and a molecular weight of 256.21 g/mol. Its IUPAC name is 3,5,11-trioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione.
| Compound Name | 3,5,11-trioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione |
|---|---|
| PubChem CID | 22623907 |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3,5,11-trioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione |
| SMILES | O=C1OC(=O)c2cc3c(c4cccc1c24)OCOC3 |
| InChI | InChI=1S/C14H8O5/c15-13-9-3-1-2-8-11(9)10(14(16)19-13)4-7-5-17-6-18-12(7)8/h1-4H,5-6H2 |
| InChIKey | ZUNRHNSMTAOKTE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|