About O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate
O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate (PubChem CID 22624060) has the molecular formula C22H18N2O4S
and a molecular weight of 406.46 g/mol. Its IUPAC name is O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate |
| PubChem CID | 22624060 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1cc2c3c(cccc3c1)C(=O)N(OCc1ccccc1)C2=O |
| InChI | InChI=1S/C22H18N2O4S/c1-23(2)22(29)28-16-11-15-9-6-10-17-19(15)18(12-16)21(26)24(20(17)25)27-13-14-7-4-3-5-8-14/h3-12H,13H2,1-2H3 |
| InChIKey | ORAQFQGEIBFOCW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate?
The IUPAC name of O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate (CID 22624060) is O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate.
What is the SMILES notation for O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate?
The canonical SMILES for O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate is CN(C)C(=S)Oc1cc2c3c(cccc3c1)C(=O)N(OCc1ccccc1)C2=O.
What is the InChIKey of O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate?
The InChIKey is ORAQFQGEIBFOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O4S/c1-23(2)22(29)28-16-11-15-9-6-10-17-19(15)18(12-16)21(26)24(20(17)25)27-13-14-7-4-3-5-8-14/h3-12H,13H2,1-2H3.
What are the key properties of O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate?
O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate has a molecular weight of 406.46 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1,3-dioxo-2-phenylmethoxybenzo[de]isoquinolin-5-yl) N,N-dimethylcarbamothioate is sourced from PubChem (CID 22624060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).