C18H21NO7S — CID 22624068
2-[[4-(3,4-dimethylphenoxy)phenyl]sulfonylmethyl]-N,2,3-trihydroxypropanamide (PubChem CID 22624068) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethylphenoxy)phenyl]sulfonylmethyl]-N,2,3-trihydroxypropanamide.
| Compound Name | 2-[[4-(3,4-dimethylphenoxy)phenyl]sulfonylmethyl]-N,2,3-trihydroxypropanamide |
|---|---|
| PubChem CID | 22624068 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[[4-(3,4-dimethylphenoxy)phenyl]sulfonylmethyl]-N,2,3-trihydroxypropanamide |
| SMILES | Cc1ccc(Oc2ccc(S(=O)(=O)CC(O)(CO)C(=O)NO)cc2)cc1C |
| InChI | InChI=1S/C18H21NO7S/c1-12-3-4-15(9-13(12)2)26-14-5-7-16(8-6-14)27(24,25)11-18(22,10-20)17(21)19-23/h3-9,20,22-23H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | ITBHAZUWOOAWQA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|