About 1-chlorothianthrene
1-chlorothianthrene (PubChem CID 22624821) has the molecular formula C12H7ClS2
and a molecular weight of 250.78 g/mol. Its IUPAC name is 1-chlorothianthrene.
Molecular Properties
| Compound Name | 1-chlorothianthrene |
| PubChem CID | 22624821 |
| Molecular Formula | C12H7ClS2 |
| Molecular Weight | 250.78 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 1-chlorothianthrene |
| SMILES | Clc1cccc2c1Sc1ccccc1S2 |
| InChI | InChI=1S/C12H7ClS2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H |
| InChIKey | NTANEBWQKLWOQD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.78 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chlorothianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorothianthrene?
The IUPAC name of 1-chlorothianthrene (CID 22624821) is 1-chlorothianthrene.
What is the SMILES notation for 1-chlorothianthrene?
The canonical SMILES for 1-chlorothianthrene is Clc1cccc2c1Sc1ccccc1S2.
What is the InChIKey of 1-chlorothianthrene?
The InChIKey is NTANEBWQKLWOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClS2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H.
What are the key properties of 1-chlorothianthrene?
1-chlorothianthrene has a molecular weight of 250.78 g/mol, XLogP of 4.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorothianthrene is sourced from PubChem (CID 22624821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).