C10H4F7NS — CID 22625182
7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzothiazole (PubChem CID 22625182) has the molecular formula C10H4F7NS and a molecular weight of 303.20 g/mol. Its IUPAC name is 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzothiazole.
| Compound Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 22625182 |
| Molecular Formula | C10H4F7NS |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzothiazole |
| SMILES | FC(F)(F)C(F)(c1cccc2ncsc12)C(F)(F)F |
| InChI | InChI=1S/C10H4F7NS/c11-8(9(12,13)14,10(15,16)17)5-2-1-3-6-7(5)19-4-18-6/h1-4H |
| InChIKey | VPBAPQYSHDXXBJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |