C4Cl4F6O — CID 22625247
1,2-dichloro-1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,2,2-trifluoroethane (PubChem CID 22625247) has the molecular formula C4Cl4F6O and a molecular weight of 319.84 g/mol. Its IUPAC name is 1,2-dichloro-1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,2,2-trifluoroethane.
| Compound Name | 1,2-dichloro-1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,2,2-trifluoroethane |
|---|---|
| PubChem CID | 22625247 |
| Molecular Formula | C4Cl4F6O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 317.86 |
| IUPAC Name | 1,2-dichloro-1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,2,2-trifluoroethane |
| SMILES | FC(F)(Cl)C(F)(Cl)OC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4Cl4F6O/c5-1(9,10)3(7,13)15-4(8,14)2(6,11)12 |
| InChIKey | HJGLRKGSIAWDBK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|