About 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid
1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 22625310) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
Analyze 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid?
The IUPAC name of 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CID 22625310) is 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid?
The canonical SMILES for 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid is O=C(O)c1ccc2c(c1O)CCCC2.
What is the InChIKey of 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid?
The InChIKey is NLVBCDOAWYJCLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h5-6,12H,1-4H2,(H,13,14).
What are the key properties of 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid?
1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid has a molecular weight of 192.21 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 22625310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).