C21H16F6O3S2 — CID 22625513
1,1,2,3,3,3-hexafluoropropane-1-sulfonate;triphenylsulfanium (PubChem CID 22625513) has the molecular formula C21H16F6O3S2 and a molecular weight of 494.48 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 22625513 |
| Molecular Formula | C21H16F6O3S2 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3H2F6O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-1(2(5,6)7)3(8,9)13(10,11)12/h1-15H;1H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | YOWQHBFDWHIXML-UHFFFAOYSA-M |
| XLogP | 5.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|