About 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde
1-hydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 22625631) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 22625631 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(O)C=CC=CC1 |
| InChI | InChI=1S/C7H8O2/c8-6-7(9)4-2-1-3-5-7/h1-4,6,9H,5H2 |
| InChIKey | IUXMIGZMKYUEBZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde (CID 22625631) is 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde is O=CC1(O)C=CC=CC1.
What is the InChIKey of 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is IUXMIGZMKYUEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c8-6-7(9)4-2-1-3-5-7/h1-4,6,9H,5H2.
What are the key properties of 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
1-hydroxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 124.14 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 22625631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).