C24H20F3N5O5 — CID 22626192
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-(2,2,2-trifluoroethylcarbamoyl)benzoic acid (PubChem CID 22626192) has the molecular formula C24H20F3N5O5 and a molecular weight of 515.45 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-(2,2,2-trifluoroethylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-(2,2,2-trifluoroethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22626192 |
| Molecular Formula | C24H20F3N5O5 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-(2,2,2-trifluoroethylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OC)ccc2-c2ccc(C(=O)NCC(F)(F)F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H20F3N5O5/c1-37-18-9-8-16(19(32-18)22(34)31-14-5-2-12(3-6-14)20(28)29)15-7-4-13(10-17(15)23(35)36)21(33)30-11-24(25,26)27/h2-10H,11H2,1H3,(H3,28,29)(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | IAXZGNIBFJWREX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|