About 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione
6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 2262624) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 2262624 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCCNc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C10H17N3O2/c1-4-5-6-11-8-7-9(14)13(3)10(15)12(8)2/h7,11H,4-6H2,1-3H3 |
| InChIKey | FVVDHTAGKNRSPB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione (CID 2262624) is 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione is CCCCNc1cc(=O)n(C)c(=O)n1C.
What is the InChIKey of 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is FVVDHTAGKNRSPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-4-5-6-11-8-7-9(14)13(3)10(15)12(8)2/h7,11H,4-6H2,1-3H3.
What are the key properties of 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione?
6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 211.26 g/mol, XLogP of 0.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(butylamino)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 2262624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).