About bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine
bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine (PubChem CID 22626300) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine |
| PubChem CID | 22626300 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine |
| SMILES | CNO.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.CH5NO/c1-2-4-7-5-6(7)3-1;1-2-3/h1-4H,5H2;2-3H,1H3 |
| InChIKey | BAAXEVYYQNREMS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine (CID 22626300) is bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine is CNO.c1ccc2c(c1)C2.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine?
The InChIKey is BAAXEVYYQNREMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.CH5NO/c1-2-4-7-5-6(7)3-1;1-2-3/h1-4H,5H2;2-3H,1H3.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine?
bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine has a molecular weight of 137.18 g/mol, XLogP of 1.19, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;N-methylhydroxylamine is sourced from PubChem (CID 22626300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).