C20H12F3N3O — CID 22626719
[2-amino-3-(2,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-6-yl]-phenylmethanone (PubChem CID 22626719) has the molecular formula C20H12F3N3O and a molecular weight of 367.33 g/mol. Its IUPAC name is [2-amino-3-(2,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-6-yl]-phenylmethanone.
| Compound Name | [2-amino-3-(2,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 22626719 |
| Molecular Formula | C20H12F3N3O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [2-amino-3-(2,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-6-yl]-phenylmethanone |
| SMILES | Nc1nc2ccc(C(=O)c3ccccc3)cn2c1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H12F3N3O/c21-14-9-16(23)15(22)8-13(14)18-20(24)25-17-7-6-12(10-26(17)18)19(27)11-4-2-1-3-5-11/h1-10H,24H2 |
| InChIKey | OXFXISVPRQXRNQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|