About cyclohexene-1,3-diamine
cyclohexene-1,3-diamine (PubChem CID 22627722) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is cyclohexene-1,3-diamine.
Molecular Properties
| Compound Name | cyclohexene-1,3-diamine |
| PubChem CID | 22627722 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | cyclohexene-1,3-diamine |
| SMILES | NC1=CC(N)CCC1 |
| InChI | InChI=1S/C6H12N2/c7-5-2-1-3-6(8)4-5/h4-5H,1-3,7-8H2 |
| InChIKey | PEVFWAALMPWLFV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1,3-diamine?
The IUPAC name of cyclohexene-1,3-diamine (CID 22627722) is cyclohexene-1,3-diamine.
What is the SMILES notation for cyclohexene-1,3-diamine?
The canonical SMILES for cyclohexene-1,3-diamine is NC1=CC(N)CCC1.
What is the InChIKey of cyclohexene-1,3-diamine?
The InChIKey is PEVFWAALMPWLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c7-5-2-1-3-6(8)4-5/h4-5H,1-3,7-8H2.
What are the key properties of cyclohexene-1,3-diamine?
cyclohexene-1,3-diamine has a molecular weight of 112.18 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1,3-diamine is sourced from PubChem (CID 22627722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).