About (E)-4-azidopent-2-ene
(E)-4-azidopent-2-ene (PubChem CID 22628667) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is (E)-4-azidopent-2-ene.
Molecular Properties
| Compound Name | (E)-4-azidopent-2-ene |
| PubChem CID | 22628667 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | (E)-4-azidopent-2-ene |
| SMILES | C/C=C/C(C)N=[N+]=[N-] |
| InChI | InChI=1S/C5H9N3/c1-3-4-5(2)7-8-6/h3-5H,1-2H3/b4-3+ |
| InChIKey | HQEUAFNCYGNBGX-ONEGZZNKSA-N |
| XLogP | 2.26 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-azidopent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-azidopent-2-ene?
The IUPAC name of (E)-4-azidopent-2-ene (CID 22628667) is (E)-4-azidopent-2-ene.
What is the SMILES notation for (E)-4-azidopent-2-ene?
The canonical SMILES for (E)-4-azidopent-2-ene is C/C=C/C(C)N=[N+]=[N-].
What is the InChIKey of (E)-4-azidopent-2-ene?
The InChIKey is HQEUAFNCYGNBGX-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H9N3/c1-3-4-5(2)7-8-6/h3-5H,1-2H3/b4-3+.
What are the key properties of (E)-4-azidopent-2-ene?
(E)-4-azidopent-2-ene has a molecular weight of 111.15 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-azidopent-2-ene is sourced from PubChem (CID 22628667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).