C17H14N8O2S — CID 22629141
5-methyl-3-[2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3-thiophen-3-ylpyrazolo[1,5-d][1,2,4]triazin-7-yl]-1,2-oxazole (PubChem CID 22629141) has the molecular formula C17H14N8O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is 5-methyl-3-[2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3-thiophen-3-ylpyrazolo[1,5-d][1,2,4]triazin-7-yl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3-thiophen-3-ylpyrazolo[1,5-d][1,2,4]triazin-7-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 22629141 |
| Molecular Formula | C17H14N8O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-methyl-3-[2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3-thiophen-3-ylpyrazolo[1,5-d][1,2,4]triazin-7-yl]-1,2-oxazole |
| SMILES | Cc1cc(-c2nncc3c(-c4ccsc4)c(OCc4ncnn4C)nn23)no1 |
| InChI | InChI=1S/C17H14N8O2S/c1-10-5-12(23-27-10)16-21-19-6-13-15(11-3-4-28-8-11)17(22-25(13)16)26-7-14-18-9-20-24(14)2/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | QNXDCVDBCFRVMI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |