About 5-(oxan-2-yl)-2H-pyran
5-(oxan-2-yl)-2H-pyran (PubChem CID 22629292) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-(oxan-2-yl)-2H-pyran.
Molecular Properties
| Compound Name | 5-(oxan-2-yl)-2H-pyran |
| PubChem CID | 22629292 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 5-(oxan-2-yl)-2H-pyran |
| SMILES | C1=CC(C2CCCCO2)=COC1 |
| InChI | InChI=1S/C10H14O2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,8,10H,1-2,5-7H2 |
| InChIKey | CMMSYDUCEOBGSG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(oxan-2-yl)-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-2-yl)-2H-pyran?
The IUPAC name of 5-(oxan-2-yl)-2H-pyran (CID 22629292) is 5-(oxan-2-yl)-2H-pyran.
What is the SMILES notation for 5-(oxan-2-yl)-2H-pyran?
The canonical SMILES for 5-(oxan-2-yl)-2H-pyran is C1=CC(C2CCCCO2)=COC1.
What is the InChIKey of 5-(oxan-2-yl)-2H-pyran?
The InChIKey is CMMSYDUCEOBGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,8,10H,1-2,5-7H2.
What are the key properties of 5-(oxan-2-yl)-2H-pyran?
5-(oxan-2-yl)-2H-pyran has a molecular weight of 166.22 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-2-yl)-2H-pyran is sourced from PubChem (CID 22629292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).