C10H20N4O2 — CID 22629436
tert-butyl (NE)-N-[amino(piperazin-1-yl)methylidene]carbamate (PubChem CID 22629436) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino(piperazin-1-yl)methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino(piperazin-1-yl)methylidene]carbamate |
|---|---|
| PubChem CID | 22629436 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | tert-butyl (NE)-N-[amino(piperazin-1-yl)methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\N)N1CCNCC1 |
| InChI | InChI=1S/C10H20N4O2/c1-10(2,3)16-9(15)13-8(11)14-6-4-12-5-7-14/h12H,4-7H2,1-3H3,(H2,11,13,15) |
| InChIKey | BDNICXBJLLVMMG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|