About 1,2-dihydroxyicosan-3-one
1,2-dihydroxyicosan-3-one (PubChem CID 22630092) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is 1,2-dihydroxyicosan-3-one.
Molecular Properties
| Compound Name | 1,2-dihydroxyicosan-3-one |
| PubChem CID | 22630092 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 1,2-dihydroxyicosan-3-one |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)C(O)CO |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20(23)18-21/h20-21,23H,2-18H2,1H3 |
| InChIKey | XRCLFBHUBAPREA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxyicosan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxyicosan-3-one?
The IUPAC name of 1,2-dihydroxyicosan-3-one (CID 22630092) is 1,2-dihydroxyicosan-3-one.
What is the SMILES notation for 1,2-dihydroxyicosan-3-one?
The canonical SMILES for 1,2-dihydroxyicosan-3-one is CCCCCCCCCCCCCCCCCC(=O)C(O)CO.
What is the InChIKey of 1,2-dihydroxyicosan-3-one?
The InChIKey is XRCLFBHUBAPREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20(23)18-21/h20-21,23H,2-18H2,1H3.
What are the key properties of 1,2-dihydroxyicosan-3-one?
1,2-dihydroxyicosan-3-one has a molecular weight of 328.54 g/mol, XLogP of 5.17, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxyicosan-3-one is sourced from PubChem (CID 22630092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).