C13H26ClN — CID 22630118
3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine;hydrochloride (PubChem CID 22630118) has the molecular formula C13H26ClN and a molecular weight of 231.81 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine;hydrochloride.
| Compound Name | 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 22630118 |
| Molecular Formula | C13H26ClN |
| Molecular Weight | 231.81 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine;hydrochloride |
| SMILES | C=CCC1(N)CC(C)(C)CC(C)(C)C1.Cl |
| InChI | InChI=1S/C13H25N.ClH/c1-6-7-13(14)9-11(2,3)8-12(4,5)10-13;/h6H,1,7-10,14H2,2-5H3;1H |
| InChIKey | PKKGFPFYCVFPIL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|