C18H32ClN — CID 22630128
1-(3,3,5,5-tetramethyl-1-prop-2-ynylcyclohexyl)piperidine;hydrochloride (PubChem CID 22630128) has the molecular formula C18H32ClN and a molecular weight of 297.91 g/mol. Its IUPAC name is 1-(3,3,5,5-tetramethyl-1-prop-2-ynylcyclohexyl)piperidine;hydrochloride.
| Compound Name | 1-(3,3,5,5-tetramethyl-1-prop-2-ynylcyclohexyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 22630128 |
| Molecular Formula | C18H32ClN |
| Molecular Weight | 297.91 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-(3,3,5,5-tetramethyl-1-prop-2-ynylcyclohexyl)piperidine;hydrochloride |
| SMILES | C#CCC1(N2CCCCC2)CC(C)(C)CC(C)(C)C1.Cl |
| InChI | InChI=1S/C18H31N.ClH/c1-6-10-18(19-11-8-7-9-12-19)14-16(2,3)13-17(4,5)15-18;/h1H,7-15H2,2-5H3;1H |
| InChIKey | GMFWICUPWBDSLV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|