About [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate
[4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate (PubChem CID 22630263) has the molecular formula C28H28F2O3
and a molecular weight of 450.53 g/mol. Its IUPAC name is [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate |
| PubChem CID | 22630263 |
| Molecular Formula | C28H28F2O3 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate |
| SMILES | CCCCCOc1ccc2c(c1)C(F)(F)c1cc(CCc3ccc(OC(C)=O)cc3)ccc1-2 |
| InChI | InChI=1S/C28H28F2O3/c1-3-4-5-16-32-23-13-15-25-24-14-10-21(17-26(24)28(29,30)27(25)18-23)7-6-20-8-11-22(12-9-20)33-19(2)31/h8-15,17-18H,3-7,16H2,1-2H3 |
| InChIKey | WHEADCQGNVPKKL-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate?
The IUPAC name of [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate (CID 22630263) is [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate.
What is the SMILES notation for [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate?
The canonical SMILES for [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate is CCCCCOc1ccc2c(c1)C(F)(F)c1cc(CCc3ccc(OC(C)=O)cc3)ccc1-2.
What is the InChIKey of [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate?
The InChIKey is WHEADCQGNVPKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28F2O3/c1-3-4-5-16-32-23-13-15-25-24-14-10-21(17-26(24)28(29,30)27(25)18-23)7-6-20-8-11-22(12-9-20)33-19(2)31/h8-15,17-18H,3-7,16H2,1-2H3.
What are the key properties of [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate?
[4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate has a molecular weight of 450.53 g/mol, XLogP of 7.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(9,9-difluoro-7-pentoxyfluoren-2-yl)ethyl]phenyl] acetate is sourced from PubChem (CID 22630263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).