About CID 22630444
CID 22630444 (PubChem CID 22630444) has the molecular formula C9H17O2Si
and a molecular weight of 185.32 g/mol.
Molecular Properties
| Compound Name | CID 22630444 |
| PubChem CID | 22630444 |
| Molecular Formula | C9H17O2Si |
| Molecular Weight | 185.32 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | — |
| SMILES | C[Si](O)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C9H17O2Si/c1-12(10)5-4-7-2-3-8-9(6-7)11-8/h7-10H,2-6H2,1H3 |
| InChIKey | PURSPEWNIPUMOS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 22630444 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22630444?
The IUPAC name of CID 22630444 (CID 22630444) is not available.
What is the SMILES notation for CID 22630444?
The canonical SMILES for CID 22630444 is C[Si](O)CCC1CCC2OC2C1.
What is the InChIKey of CID 22630444?
The InChIKey is PURSPEWNIPUMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O2Si/c1-12(10)5-4-7-2-3-8-9(6-7)11-8/h7-10H,2-6H2,1H3.
What are the key properties of CID 22630444?
CID 22630444 has a molecular weight of 185.32 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22630444 is sourced from PubChem (CID 22630444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).