C42H72N2O5 — CID 22630573
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butylphenyl)-hydroxymethyl]propanedioate (PubChem CID 22630573) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butylphenyl)-hydroxymethyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butylphenyl)-hydroxymethyl]propanedioate |
|---|---|
| PubChem CID | 22630573 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butylphenyl)-hydroxymethyl]propanedioate |
| SMILES | CCCCC(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H72N2O5/c1-18-19-20-42(34(46)48-31-24-38(8,9)43(16)39(10,11)25-31,35(47)49-32-26-40(12,13)44(17)41(14,15)27-32)33(45)28-21-29(36(2,3)4)23-30(22-28)37(5,6)7/h21-23,31-33,45H,18-20,24-27H2,1-17H3 |
| InChIKey | RXOSMIXKSDDLLA-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|