About N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline
N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline (PubChem CID 22630576) has the molecular formula C28H35N
and a molecular weight of 385.60 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline.
Molecular Properties
| Compound Name | N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline |
| PubChem CID | 22630576 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C28H35N/c1-20-9-14-26(19-21(20)2)29(24-15-10-22(11-16-24)27(3,4)5)25-17-12-23(13-18-25)28(6,7)8/h9-19H,1-8H3 |
| InChIKey | BSOJRVVDZMQVEI-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline?
The IUPAC name of N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline (CID 22630576) is N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline.
What is the SMILES notation for N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline?
The canonical SMILES for N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline is Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1C.
What is the InChIKey of N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline?
The InChIKey is BSOJRVVDZMQVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35N/c1-20-9-14-26(19-21(20)2)29(24-15-10-22(11-16-24)27(3,4)5)25-17-12-23(13-18-25)28(6,7)8/h9-19H,1-8H3.
What are the key properties of N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline?
N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline has a molecular weight of 385.60 g/mol, XLogP of 8.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(4-tert-butylphenyl)-3,4-dimethylaniline is sourced from PubChem (CID 22630576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).