C45H30N2O10 — CID 22630612
4-[5-[4-[2-[4-[4-(4-carboxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-1,3-dioxoisoindol-4-yl]benzoic acid (PubChem CID 22630612) has the molecular formula C45H30N2O10 and a molecular weight of 758.74 g/mol. Its IUPAC name is 4-[5-[4-[2-[4-[4-(4-carboxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-1,3-dioxoisoindol-4-yl]benzoic acid.
| Compound Name | 4-[5-[4-[2-[4-[4-(4-carboxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-1,3-dioxoisoindol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 22630612 |
| Molecular Formula | C45H30N2O10 |
| Molecular Weight | 758.74 g/mol |
| Exact Mass | 758.19 |
| IUPAC Name | 4-[5-[4-[2-[4-[4-(4-carboxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]-1,3-dioxoisoindol-4-yl]benzoic acid |
| SMILES | CC(C)(c1ccc(Oc2ccc3c(c2-c2ccc(C(=O)O)cc2)C(=O)NC3=O)cc1)c1ccc(Oc2ccc3c(c2-c2ccc(C(=O)O)cc2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C45H30N2O10/c1-45(2,27-11-15-29(16-12-27)56-33-21-19-31-37(41(50)46-39(31)48)35(33)23-3-7-25(8-4-23)43(52)53)28-13-17-30(18-14-28)57-34-22-20-32-38(42(51)47-40(32)49)36(34)24-5-9-26(10-6-24)44(54)55/h3-22H,1-2H3,(H,52,53)(H,54,55)(H,46,48,50)(H,47,49,51) |
| InChIKey | ZFQRCGKDCNNLHL-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.74 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|