About 1-aminoisoquinolin-7-ol
1-aminoisoquinolin-7-ol (PubChem CID 22631313) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-aminoisoquinolin-7-ol.
Molecular Properties
| Compound Name | 1-aminoisoquinolin-7-ol |
| PubChem CID | 22631313 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-aminoisoquinolin-7-ol |
| SMILES | Nc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C9H8N2O/c10-9-8-5-7(12)2-1-6(8)3-4-11-9/h1-5,12H,(H2,10,11) |
| InChIKey | RXUCSGSFYHUFFS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminoisoquinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoisoquinolin-7-ol?
The IUPAC name of 1-aminoisoquinolin-7-ol (CID 22631313) is 1-aminoisoquinolin-7-ol.
What is the SMILES notation for 1-aminoisoquinolin-7-ol?
The canonical SMILES for 1-aminoisoquinolin-7-ol is Nc1nccc2ccc(O)cc12.
What is the InChIKey of 1-aminoisoquinolin-7-ol?
The InChIKey is RXUCSGSFYHUFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-9-8-5-7(12)2-1-6(8)3-4-11-9/h1-5,12H,(H2,10,11).
What are the key properties of 1-aminoisoquinolin-7-ol?
1-aminoisoquinolin-7-ol has a molecular weight of 160.18 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoisoquinolin-7-ol is sourced from PubChem (CID 22631313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).